CAS 99218-62-9
:Benzoic acid, 2-[(2,3-dimethylphenyl)amino]-, potassium salt (1:1)
Description:
Benzoic acid, 2-[(2,3-dimethylphenyl)amino]-, potassium salt (1:1), with the CAS number 99218-62-9, is a chemical compound that features a benzoic acid moiety substituted with an amino group attached to a dimethylphenyl group. This compound is characterized by its ionic nature due to the presence of the potassium salt, which enhances its solubility in polar solvents. The structure includes a carboxylic acid functional group, contributing to its acidic properties, while the amino group can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. The dimethylphenyl substituent adds hydrophobic characteristics, which can affect the compound's overall solubility and biological activity. This compound may exhibit antimicrobial properties and is often studied for its potential applications in pharmaceuticals and agrochemicals. Its stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature, making it important to consider these factors in practical applications.
Formula:C15H15NO2·K
InChI:InChI=1S/C15H15NO2.K/c1-10-6-5-9-13(11(10)2)16-14-8-4-3-7-12(14)15(17)18;/h3-9,16H,1-2H3,(H,17,18);
InChI key:InChIKey=ULIUWVZHXJXSBK-UHFFFAOYSA-N
SMILES:N(C1=C(C(O)=O)C=CC=C1)C2=C(C)C(C)=CC=C2.[K]
Synonyms:- Benzoic acid, 2-[(2,3-dimethylphenyl)amino]-, monopotassium salt
- Benzoic acid, 2-[(2,3-dimethylphenyl)amino]-, potassium salt (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
