CAS 99257-07-5

2-deoxy-2-fluoro-6-O-phosphono-D-gluconic acid

Description:

2-Deoxy-2-fluoro-6-O-phosphono-D-gluconic acid is a synthetic analog of glucose that features a fluorine atom substitution at the second carbon and a phosphonate group at the sixth position. This compound is characterized by its unique structural modifications, which influence its biochemical properties and interactions. The presence of the fluorine atom can enhance the stability of the molecule and alter its reactivity compared to its non-fluorinated counterparts. The phosphono group contributes to its potential as a biochemical tool, particularly in studies related to metabolic pathways and enzyme interactions. This compound is often utilized in research settings, particularly in the fields of biochemistry and medicinal chemistry, to investigate the mechanisms of carbohydrate metabolism and to develop potential therapeutic agents. Its solubility and reactivity can vary based on the pH and ionic strength of the solution, making it important to consider these factors during experimental applications. Overall, 2-deoxy-2-fluoro-6-O-phosphono-D-gluconic acid serves as a valuable compound for exploring the complexities of carbohydrate chemistry and its biological implications.

Formula: C₆H₁₂FO₉P

InChI: InChI=1/C6H12FO9P/c7-3(6(11)12)5(10)4(9)2(8)1-16-17(13,14)15/h2-5,8-10H,1H2,(H,11,12)(H2,13,14,15)/t2-,3-,4-,5-/m1/s1

SMILES: C([C@H]([C@H]([C@@H]([C@H](C(=O)O)F)O)O)O)OP(=O)(O)O