CAS 99260-73-8
:glycocinnasperimicin D
Description:
Glycocinnasperimicin D, with the CAS number 99260-73-8, is a natural product belonging to the class of compounds known as glycosylated antibiotics. It is derived from certain strains of bacteria, particularly those in the genus Micromonospora. This compound exhibits notable antibacterial properties, making it of interest in the field of medicinal chemistry and pharmacology. Glycocinnasperimicin D is characterized by its complex molecular structure, which includes a glycosyl moiety that enhances its solubility and bioactivity. The presence of specific functional groups contributes to its mechanism of action, which typically involves inhibition of bacterial protein synthesis. Research into glycocinnasperimicin D has highlighted its potential therapeutic applications, particularly against resistant bacterial strains. Additionally, its biosynthetic pathways and the genetic basis for its production are subjects of ongoing investigation, as understanding these aspects could lead to improved synthetic methods or analogs with enhanced efficacy. Overall, glycocinnasperimicin D represents a significant compound in the search for new antibiotics in an era of increasing antimicrobial resistance.
Formula:C30H50N10O9
InChI:InChI=1/C30H50N10O9/c1-16-21(39-30(46)40-26-22(38-29(34)45)24(43)19(41)15-47-26)25(44)23(37-28(32)33)27(48-16)49-18-8-5-17(6-9-18)7-10-20(42)36-14-4-13-35-12-3-2-11-31/h5-10,16,19,21-27,35,41,43-44H,2-4,11-15,31H2,1H3,(H,36,42)(H4,32,33,37)(H3,34,38,45)(H2,39,40,46)/b10-7+
Synonyms:- (E)-N-[3-(4-aminobutylamino)propyl]-3-[4-[5-[[3-(carbamoylamino)-4,5-dihydroxyoxan-2-yl]carbamoylamino]-3-(diaminomethylideneamino)-4-hydroxy-6-methyloxan-2-yl]oxyphenyl]prop-2-enamide
- 2-Propenamide, N-[3-[(4-aminobutyl)amino]propyl]-3-[4-[[4-[[[[2-[(aminocarbonyl)amino]-2-deoxy-β-D-xylopyranosyl]amino]carbonyl]amino]-2-[(aminoiminomethyl)amino]-2,4,6-trideoxy-α-D-glucopyranosyl]oxy]phenyl]-, (2E)-
- glycocinnasperimicin D
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Glycocinnasperimicin D
CAS:Glycocinnasperimicin D is a glycoside cinnamoyl iminohistamine antibiotic. It exhibits activity against both Gram-positive and Gram-negative bacteria. Additionally, Glycocinnasperimicin D inhibits leukemia L1210 cells, with an IC50 of 2.0 μg/mL.Formula:C30H50N10O9Color and Shape:SolidMolecular weight:694.78
