CymitQuimica logo

CAS 99282-16-3

:

3-(fluoromethyl)but-3-en-1-yl trihydrogen diphosphate

Description:
3-(Fluoromethyl)but-3-en-1-yl trihydrogen diphosphate is a chemical compound characterized by its unique structure, which includes a fluoromethyl group and a diphosphate moiety. This compound features a butenyl backbone, indicating the presence of a double bond, which contributes to its reactivity and potential applications in biochemical processes. The trihydrogen diphosphate group suggests that it can participate in phosphorylation reactions, making it relevant in metabolic pathways and energy transfer mechanisms, similar to adenosine triphosphate (ATP). The presence of the fluoromethyl group may enhance its stability or alter its interaction with biological targets. This compound is likely to be of interest in medicinal chemistry and biochemistry, particularly in the study of enzyme mechanisms or as a potential inhibitor or substrate in various biochemical reactions. Its specific properties, such as solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other reactants or solvents.
Formula:C5H11FO7P2
InChI:InChI=1/C5H11FO7P2/c1-5(4-6)2-3-12-15(10,11)13-14(7,8)9/h1-4H2,(H,10,11)(H2,7,8,9)
SMILES:C=C(CCOP(=O)(O)OP(=O)(O)O)CF
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.