CAS 99283-01-9
:Bensulfuron
Description:
Bensulfuron is a selective herbicide primarily used for controlling broadleaf weeds and certain grasses in various crops, particularly rice. It belongs to the sulfonylurea class of herbicides, which function by inhibiting the enzyme acetolactate synthase (ALS), crucial for amino acid synthesis in plants. This inhibition leads to the cessation of growth and eventual death of the targeted weeds. Bensulfuron is characterized by its relatively low toxicity to mammals and birds, making it a preferred choice in agricultural applications. It is typically applied pre-emergence or post-emergence, depending on the specific weed species and crop type. The compound is soluble in water and has a moderate persistence in the environment, necessitating careful management to minimize potential impacts on non-target species and ecosystems. As with all herbicides, adherence to recommended application rates and timing is essential to maximize efficacy while minimizing environmental risks.
Formula:C15H16N4O7S
InChI:InChI=1S/C15H16N4O7S/c1-25-11-7-12(26-2)17-14(16-11)18-15(22)19-27(23,24)8-9-5-3-4-6-10(9)13(20)21/h3-7H,8H2,1-2H3,(H,20,21)(H2,16,17,18,19,22)
InChI key:InChIKey=PPWBRCCBKOWDNB-UHFFFAOYSA-N
SMILES:C(S(NC(NC=1N=C(OC)C=C(OC)N1)=O)(=O)=O)C2=C(C(O)=O)C=CC=C2
Synonyms:- 2-({[(4,6-Dimethoxypyrimidin-2-Yl)Carbamoyl]Sulfamoyl}Methyl)Benzoic Acid
- 2-[[[[[(4,6-Dimethoxy-2-Pyrimidinyl)Amino]Carbonyl]Amino]Sulfonyl]Methyl]Benzoic Acid
- A-[(4,6-Dimethoxypyrimidin-2-Ylcarbamoyl)Sulfamoyl]-O-Toluic Acid
- Benzoic acid, 2-[[[[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]methyl]-
- Bensulfuron
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
