CAS 99304-37-7
:5-Bromo-3-hydroxy-2-indolinone
Description:
5-Bromo-3-hydroxy-2-indolinone is an organic compound characterized by its indolinone structure, which features a fused bicyclic system containing a nitrogen atom. This compound is notable for the presence of a bromine atom at the 5-position and a hydroxyl group at the 3-position of the indolinone ring. It typically appears as a solid at room temperature and is soluble in polar organic solvents. The presence of the bromine substituent can influence its reactivity, making it useful in various chemical reactions, including electrophilic substitutions and coupling reactions. The hydroxyl group contributes to its potential as a hydrogen bond donor, which may enhance its interactions in biological systems. This compound has garnered interest in medicinal chemistry due to its potential biological activities, including antimicrobial and anticancer properties. As with many indolinone derivatives, it may serve as a scaffold for the development of new pharmaceuticals. Proper handling and safety measures should be observed, as with all chemical substances, due to potential toxicity and reactivity.
Formula:C8H6BrNO2
InChI:InChI=1/C8H6BrNO2/c9-4-1-2-6-5(3-4)7(11)8(12)10-6/h1-3,7,11H,(H,10,12)
SMILES:c1cc2c(cc1Br)C(C(=N2)O)O
Synonyms:- (3R)-5-bromo-3-hydroxy-1,3-dihydro-2H-indol-2-one
- (3S)-5-bromo-3-hydroxy-1,3-dihydro-2H-indol-2-one
- 5-bromo-3-hydroxy-1,3-dihydro-2H-indol-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
