CAS 99305-82-5

Phosphonic acid, 2-pyrrolidinyl-, monophenyl ester

Description:

Phosphonic acid, 2-pyrrolidinyl-, monophenyl ester, identified by CAS number 99305-82-5, is an organophosphorus compound characterized by the presence of a phosphonic acid functional group and a pyrrolidine ring. This compound typically exhibits properties associated with phosphonic acids, such as being a strong acid due to the presence of the phosphonic moiety. The pyrrolidine group contributes to its potential as a chiral center, which may influence its reactivity and interactions in biological systems. The monophenyl ester indicates that one of the hydroxyl groups of the phosphonic acid is esterified with a phenyl group, which can enhance lipophilicity and affect solubility in organic solvents. This compound may have applications in various fields, including agriculture as a herbicide or in pharmaceuticals due to its potential biological activity. Its stability, reactivity, and specific interactions would depend on the surrounding conditions, such as pH and temperature, making it a subject of interest in both synthetic and applied chemistry.

Formula: C₁₀H₁₄NO₃P

InChI: InChI=1S/C10H14NO3P/c12-15(13,10-7-4-8-11-10)14-9-5-2-1-3-6-9/h1-3,5-6,10-11H,4,7-8H2,(H,12,13)

InChI key: ZJSSCIORWSJOFW-UHFFFAOYSA-N

SMILES: C1CC(NC1)P(=O)(O)OC2=CC=CC=C2