CymitQuimica logo

CAS 99324-97-7

:

1,1,1,2-Tetrafluoro-6-iodo-2-(trifluoromethyl)hexane

Description:
1,1,1,2-Tetrafluoro-6-iodo-2-(trifluoromethyl)hexane is a halogenated organic compound characterized by the presence of multiple fluorine and iodine atoms, which significantly influence its chemical properties. This compound features a hexane backbone, with a trifluoromethyl group and an iodine substituent, contributing to its unique reactivity and stability. The presence of fluorine atoms typically enhances the compound's lipophilicity and thermal stability, making it resistant to degradation. Additionally, the iodine atom can introduce specific reactivity patterns, such as potential nucleophilic substitution reactions. This compound may be of interest in various applications, including pharmaceuticals, agrochemicals, and materials science, due to its unique electronic properties and potential for functionalization. However, the environmental impact and regulatory considerations associated with halogenated compounds should also be taken into account, as they can exhibit persistence and bioaccumulation in ecosystems. Overall, 1,1,1,2-Tetrafluoro-6-iodo-2-(trifluoromethyl)hexane represents a complex structure with significant implications for both chemical behavior and application.
Formula:C7H8F7I
InChI:InChI=1S/C7H8F7I/c8-5(6(9,10)11,7(12,13)14)3-1-2-4-15/h1-4H2
InChI key:InChIKey=AMVCCXPQNKKJDX-UHFFFAOYSA-N
SMILES:C(CCCCI)(C(F)(F)F)(C(F)(F)F)F
Synonyms:
  • 1,1,1,2-Tetrafluoro-6-iodo-2-(trifluoromethyl)hexane
  • Hexane, 1,1,1,2-tetrafluoro-6-iodo-2-(trifluoromethyl)-
  • 1,1,1,2-Tetrafluoro-2-(trifluoromethyl)-6-iodohexane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.