CAS 99329-51-8
:ethyl 1-ethyl-4-oxopiperidine-3-carboxylate
Description:
Ethyl 1-ethyl-4-oxopiperidine-3-carboxylate, with the CAS number 99329-51-8, is a chemical compound that belongs to the class of piperidine derivatives. This substance features a piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle, and is characterized by the presence of a carboxylate group and a ketone functionality. The ethyl ester group contributes to its solubility in organic solvents and may influence its reactivity and biological activity. Typically, compounds of this nature can exhibit a range of properties, including potential applications in medicinal chemistry, where they may serve as intermediates in the synthesis of pharmaceuticals or as bioactive agents. The presence of the oxo group suggests that it may participate in various chemical reactions, such as nucleophilic additions or condensation reactions. As with many organic compounds, the specific characteristics, such as melting point, boiling point, and reactivity, would depend on the molecular structure and the conditions under which the compound is studied.
Formula:C10H17NO3
InChI:InChI=1/C10H17NO3/c1-3-11-6-5-9(12)8(7-11)10(13)14-4-2/h8H,3-7H2,1-2H3
SMILES:CCN1CCC(=O)C(C1)C(=O)OCC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.