CymitQuimica logo

CAS 99329-70-1

:

4-(3-chlorophenyl)piperidine hydrochloride

Description:
4-(3-Chlorophenyl)piperidine hydrochloride is a chemical compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing ring. The presence of a 3-chlorophenyl group indicates that a chlorine atom is substituted on the phenyl ring at the para position relative to the piperidine nitrogen. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and makes it easier to handle in various applications. It is often studied for its potential pharmacological properties, particularly in the context of neuroscience and medicinal chemistry, where it may exhibit activity related to neurotransmitter systems. The compound's molecular structure contributes to its biological activity, and it may interact with specific receptors or enzymes in the body. As with many chemical substances, safety and handling precautions are essential, as it may pose risks if not managed properly. Overall, 4-(3-chlorophenyl)piperidine hydrochloride is of interest in research settings, particularly in the development of therapeutic agents.
Formula:C11H15Cl2N
InChI:InChI=1/C11H14ClN.ClH/c12-11-3-1-2-10(8-11)9-4-6-13-7-5-9;/h1-3,8-9,13H,4-7H2;1H
InChI key:SAXMEDYZBPHVLK-UHFFFAOYSA-N
SMILES:c1cc(cc(c1)Cl)C1CCNCC1.Cl
Synonyms:
  • 4-(3-Chlorophenyl)piperidine hydrochloride (1:1)
  • Piperidine, 4-(3-chlorophenyl)-, hydrochloride (1:1)
Found 5 products.