CAS 99333-34-3
:2,2,2-trifluoro-N-(4-methoxyphenyl)ethanimine
Description:
2,2,2-Trifluoro-N-(4-methoxyphenyl)ethanimine is an organic compound characterized by its unique structure, which includes a trifluoroethyl group and a methoxy-substituted phenyl group. The presence of three fluorine atoms contributes to its high electronegativity and potential reactivity, particularly in nucleophilic substitution reactions. The methoxy group enhances the compound's solubility in organic solvents and may influence its electronic properties, making it a candidate for various applications in pharmaceuticals and agrochemicals. This compound is likely to exhibit polar characteristics due to the electronegative fluorine atoms and the methoxy group, which can affect its interaction with biological systems. Additionally, the imine functional group (C=N) can participate in various chemical reactions, including condensation and hydrolysis. Safety data should be consulted for handling, as fluorinated compounds can pose specific health and environmental risks. Overall, 2,2,2-trifluoro-N-(4-methoxyphenyl)ethanimine represents a versatile structure with potential utility in synthetic organic chemistry.
Formula:C9H8F3NO
InChI:InChI=1/C9H8F3NO/c1-14-8-4-2-7(3-5-8)13-6-9(10,11)12/h2-6H,1H3
SMILES:COc1ccc(cc1)N=CC(F)(F)F
Synonyms:- 4-Methoxy-N-(2,2,2-trifluoroethylidene)aniline
- benzenamine, 4-methoxy-N-(2,2,2-trifluoroethylidene)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.