CAS 99347-22-5

1H-Benzimidazole, 2-hydrazinyl-3a,4,5,6,7,7a-hexahydro-, hydrobromide (1:1)

Description:

1H-Benzimidazole, 2-hydrazinyl-3a,4,5,6,7,7a-hexahydro-, hydrobromide (1:1), with CAS number 99347-22-5, is a chemical compound characterized by its complex structure that includes a benzimidazole core and a hydrazine functional group. This compound typically appears as a crystalline solid and is soluble in polar solvents, which is common for many hydrobromide salts. The presence of the hydrazinyl group suggests potential reactivity, particularly in forming hydrazones or undergoing oxidation reactions. Its hexahydro structure indicates that it contains multiple saturated carbon atoms, contributing to its stability and potentially influencing its biological activity. Compounds of this nature may exhibit pharmacological properties, making them of interest in medicinal chemistry. However, specific applications, safety data, and handling precautions should be referenced from material safety data sheets or relevant literature, as they can vary based on the compound's use and formulation.

Formula: C₇H₁₄N₄·BrH

InChI: InChI=1S/C7H14N4.BrH/c8-11-7-9-5-3-1-2-4-6(5)10-7;/h5-6H,1-4,8H2,(H2,9,10,11);1H

InChI key: InChIKey=BYJGPKZXKZJIQS-UHFFFAOYSA-N

SMILES: N(N)=C1NC2C(N1)CCCC2.Br

Synonyms:

• 2H-Benzimidazol-2-one, octahydro-, hydrazone, monohydrobromide
• 1H-Benzimidazole, 2-hydrazinyl-3a,4,5,6,7,7a-hexahydro-, hydrobromide (1:1)
• 2-Hydrazinyl-3a,4,5,6,7,7a-hexahydro-1H-1,3-benzodiazole hydrobromide

2-Hydrazinyl-3a,4,5,6,7,7a-hexahydro-1H-1,3-benzodiazole hydrobromide

CAS: 99347-22-5

Versatile small molecule scaffold

Formula: C₇H₁₅BrN₄

Purity: Min. 95%

Molecular weight: 235.13 g/mol

Ref: 3D-ZDA34722