CymitQuimica logo

CAS 99358-35-7

:

2-hydroxy-3-(4-hydroxy-3-nitrophenyl)propanoic acid

Description:
2-Hydroxy-3-(4-hydroxy-3-nitrophenyl)propanoic acid, also known by its CAS number 99358-35-7, is an organic compound characterized by its aromatic and carboxylic acid functional groups. This compound features a propanoic acid backbone with a hydroxyl group and a nitrophenyl substituent, which contributes to its potential biological activity and reactivity. The presence of the nitro group typically enhances the compound's electron-withdrawing properties, influencing its chemical behavior and interactions. It is likely to exhibit solubility in polar solvents due to the hydroxyl and carboxylic acid groups, while its aromatic structure may provide stability and facilitate π-π stacking interactions. This compound may be of interest in various fields, including pharmaceuticals and materials science, due to its potential applications in drug development or as a precursor in organic synthesis. However, specific safety and handling guidelines should be followed, as compounds with nitro groups can sometimes exhibit toxicity or environmental concerns.
Formula:C9H9NO6
InChI:InChI=1/C9H9NO6/c11-7-2-1-5(3-6(7)10(15)16)4-8(12)9(13)14/h1-3,8,11-12H,4H2,(H,13,14)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.