CymitQuimica logo

CAS 99359-32-7

:

L-Phenylalanine,4-bromo-, methyl ester, hydrochloride (1:1)

Description:
L-Phenylalanine, 4-bromo-, methyl ester, hydrochloride (1:1) is a chemical compound that belongs to the class of amino acids and their derivatives. It is a derivative of the essential amino acid L-phenylalanine, which is crucial for protein synthesis and is involved in various metabolic processes. The presence of the bromo substituent at the 4-position of the phenyl ring introduces unique reactivity and potential biological activity. As a methyl ester, it indicates that the carboxylic acid group of L-phenylalanine has been esterified, which can influence its solubility and reactivity. The hydrochloride form suggests that the compound is a salt, enhancing its stability and solubility in aqueous solutions. This compound may be of interest in pharmaceutical research, particularly in the development of drugs targeting neurological disorders, as phenylalanine is a precursor to neurotransmitters. Its specific properties, such as melting point, solubility, and reactivity, would be determined through experimental characterization.
Formula:C10H12BrNO2ClH
InChI:InChI=1S/C10H12BrNO2.ClH/c1-14-10(13)9(12)6-7-2-4-8(11)5-3-7;/h2-5,9H,6,12H2,1H3;1H/t9-;/m0./s1
InChI key:MCYQWPUGHHRKME-FVGYRXGTSA-N
SMILES:COC(=O)[C@H](CC1=CC=C(C=C1)Br)N.Cl
Synonyms:
  • Alanine,3-(p-bromophenyl)-, methyl ester, hydrochloride, L-
  • L-Phenylalanine,4-bromo-, methyl ester, hydrochloride
  • L-4-Bromophenylalanine methylester hydrochloride
  • H-Phe(4-Br)-OMe・HCl
Found 3 products.