CAS 99359-34-9

1-(4-Bromobutyl)-4-nitrobenzene

Description:

1-(4-Bromobutyl)-4-nitrobenzene is an organic compound characterized by its aromatic structure, featuring a nitro group (-NO2) and a bromobutyl substituent. The presence of the nitro group indicates that it is likely to exhibit electrophilic reactivity, making it a potential candidate for further chemical transformations. The bromobutyl moiety contributes to its hydrophobic characteristics, which can influence its solubility in various solvents. This compound is typically a solid at room temperature and may have moderate stability under standard conditions. Its molecular structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the bromine atom can serve as a leaving group in nucleophilic substitution reactions, while the nitro group can participate in reduction reactions. Safety considerations should be taken into account due to the presence of both bromine and nitro functional groups, which can pose health and environmental risks. Proper handling and disposal methods are essential when working with this compound in a laboratory setting.

Formula: C₁₀H₁₂BrNO₂

InChI: InChI=1S/C10H12BrNO2/c11-8-2-1-3-9-4-6-10(7-5-9)12(13)14/h4-7H,1-3,8H2

InChI key: InChIKey=GTNVWVLCXAHTCJ-UHFFFAOYSA-N

SMILES: C(CCCBr)C1=CC=C(N(=O)=O)C=C1

Synonyms:

• 1-(4-Bromobutyl)-4-nitrobenzene
• Benzene, 1-(4-bromobutyl)-4-nitro-