
CAS 99361-10-1
:6-(Iodomethyl)quinoline
Description:
6-(Iodomethyl)quinoline is a chemical compound characterized by its quinoline backbone, which is a bicyclic structure consisting of a benzene ring fused to a pyridine ring. The presence of the iodomethyl group at the 6-position of the quinoline structure introduces a halogen substituent, which can significantly influence the compound's reactivity and properties. This compound is typically a pale yellow to brown solid and is soluble in organic solvents. It is often used in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. The iodomethyl group can serve as a leaving group, facilitating further functionalization of the quinoline ring. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Safety precautions should be taken when handling this compound, as it may pose health risks associated with halogenated organic compounds.
Formula:C10H8IN
InChI:InChI=1S/C10H8IN/c11-7-8-3-4-10-9(6-8)2-1-5-12-10/h1-6H,7H2
InChI key:InChIKey=WQQMYKMZGVNMIC-UHFFFAOYSA-N
SMILES:C(I)C1=CC2=C(C=C1)N=CC=C2
Synonyms:- 6-(Iodomethyl)quinoline
- Quinoline, 6-(iodomethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.