CymitQuimica logo

CAS 99361-29-2

:

3-phenyl-2-thioxo-2,3-dihydro-1H-imidazole-4-carboxylic acid

Description:
3-Phenyl-2-thioxo-2,3-dihydro-1H-imidazole-4-carboxylic acid is a heterocyclic compound characterized by its imidazole ring structure, which includes a thioxo group and a carboxylic acid functional group. This compound features a phenyl substituent that contributes to its aromatic properties and potential reactivity. The thioxo group (–C=S) enhances its chemical reactivity, making it a candidate for various synthetic applications, including the development of pharmaceuticals or agrochemicals. The presence of the carboxylic acid group (–COOH) provides acidic properties, allowing for potential interactions in biological systems or with other chemical entities. The compound's structure suggests it may exhibit biological activity, possibly as an enzyme inhibitor or in other biochemical pathways. Its solubility and stability can vary depending on the solvent and conditions, which is important for its practical applications. Overall, 3-phenyl-2-thioxo-2,3-dihydro-1H-imidazole-4-carboxylic acid is a versatile compound with potential utility in medicinal chemistry and organic synthesis.
Formula:C10H8N2O2S
InChI:InChI=1/C10H8N2O2S/c13-9(14)8-6-11-10(15)12(8)7-4-2-1-3-5-7/h1-6H,(H,11,15)(H,13,14)
SMILES:c1ccc(cc1)n1c(cnc1S)C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.