CymitQuimica logo

CAS 99362-32-0

:

2-[(2-Aminoethyl)amino]benzoic acid

Description:
2-[(2-Aminoethyl)amino]benzoic acid, also known as 2-(2-aminoethylamino)benzoic acid, is an organic compound characterized by its amino acid structure, which includes both an amino group and a carboxylic acid functional group. This compound features a benzene ring substituted with an aminoethyl side chain, contributing to its basic properties. It is typically a white to off-white crystalline solid that is soluble in water due to the presence of polar functional groups. The presence of multiple amino groups allows for potential interactions in biological systems, making it of interest in pharmaceutical and biochemical research. Its CAS number, 99362-32-0, is a unique identifier that facilitates the identification and study of this compound in scientific literature and databases. The compound may exhibit properties such as buffering capacity and can participate in various chemical reactions, including peptide bond formation, which is relevant in the synthesis of peptides and proteins. Overall, its structural features suggest potential applications in medicinal chemistry and biochemistry.
Formula:C9H12N2O2
InChI:InChI=1S/C9H12N2O2/c10-5-6-11-8-4-2-1-3-7(8)9(12)13/h1-4,11H,5-6,10H2,(H,12,13)
InChI key:InChIKey=HURDEDXDUKZIPA-UHFFFAOYSA-N
SMILES:N(CCN)C1=C(C(O)=O)C=CC=C1
Synonyms:
  • 2-[(2-Aminoethyl)amino]benzoic acid
  • NSC 173180
  • Benzoic acid, 2-[(2-aminoethyl)amino]-
  • Anthranilic acid, N-(2-aminoethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.