
CAS 99363-37-8
:Polysiloxanes, 3-aminopropyl Me, di-Me
Description:
Polysiloxanes, specifically the compound known as 3-aminopropyl methyl dimethylsiloxane (CAS 99363-37-8), are a class of silicone-based polymers characterized by a backbone of alternating silicon and oxygen atoms. This particular polysiloxane features amino groups, which impart unique properties such as enhanced reactivity and the ability to form hydrogen bonds, making it useful in various applications including adhesives, sealants, and surface modifiers. The presence of methyl groups contributes to its hydrophobic nature, while the amino propyl groups can enhance compatibility with organic materials and improve adhesion to substrates. These compounds are typically characterized by their flexibility, thermal stability, and resistance to chemical degradation. Additionally, they can exhibit varying viscosities depending on their molecular weight and structure, allowing for tailored properties for specific applications. Overall, polysiloxanes with amino functional groups are valuable in industries ranging from automotive to electronics, where their unique characteristics can be leveraged for improved performance and durability.
Formula:Unspecified
Synonyms:- Siloxanes and Silicones, 3-aminopropyl Me, di-Me
- GP 4 (siloxane)
- 3-Aminopropyl Me, di-Me siloxanes
- Polysiloxanes, 3-aminopropyl Me, di-Me
- X 22-3801C
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
(20-25% AMINOPROPYLMETHYLSILOXANE) - DIMETHYLSILOXANE COPOLYMER, 900-1,100 cSt
CAS:Color and Shape:LiquidMolecular weight:0.0Polysiloxanes, 3-aminopropyl Me, di-Me
CAS:Formula:C12H35NO3Si4Purity:9%Color and Shape:LiquidMolecular weight:353.7532(6-7% Aminopropylmethylsiloxane) - Dimethylsiloxane copolymer, 1,800-2,200 cSt
CAS:AMS-163 - (6-7% Aminopropylmethylsiloxane) - Dimethylsiloxane copolymer, 1,800-2,200 cSt
Formula:(C2H5OSi)n(C2H6OSi)nC8H24NOSi2Purity:7%Color and Shape:Liquid(6-7% Aminopropylmethylsiloxane)-dimethylsiloxane Co-polymer cSt 80-120
CAS:AMS-162 - (6-7% Aminopropylmethylsiloxane)-dimethylsiloxane Co-polymer cSt 80-120
Formula:(C2H5OSi)n(C2H6OSi)nC8H24NOSi2Purity:7%Color and Shape:Liquid, Clear to pale yellow liquidMolecular weight:7000-9000(20-25% AMINOPROPYLMETHYLSILOXANE) - DIMETHYLSILOXANE COPOLYMER, 900-1,100 cSt
CAS:Color and Shape:Colorless To Pale Yellow LiquidMolecular weight:20000.0(2-3% Aminopropylmethylsiloxane)-dimethylsiloxane copolymer 80-200 cSt
CAS:AMS-132 - (2-3% Aminopropylmethylsiloxane)-dimethylsiloxane copolymer 80-200 cSt
Formula:(C2H5OSi)n(C2H6OSi)nC8H24NOSi2Color and Shape:LiquidMolecular weight:0(6-7% AMINOPROPYLMETHYLSILOXANE) - DIMETHYLSILOXANE COPOLYMER, 80-120 cSt
CAS:Color and Shape:Colorless To Pale Yellow LiquidMolecular weight:4000-5000(2-3% AMINOPROPYLMETHYLSILOXANE) - DIMETHYLSILOXANE COPOLYMER, 80-120 cSt
CAS:Color and Shape:Colorless To Pale Yellow LiquidMolecular weight:4500-6000



