CAS 99365-69-2
:7-nitro-1,2,3,4-tetrahydroisoquinoline hydrochloride (1:1)
Description:
7-Nitro-1,2,3,4-tetrahydroisoquinoline hydrochloride is a chemical compound characterized by its unique structure, which includes a tetrahydroisoquinoline core with a nitro group at the 7-position. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates its use in various applications, particularly in medicinal chemistry and pharmacological research. The presence of the nitro group can influence the compound's reactivity and biological activity, making it a subject of interest in studies related to neuropharmacology and potential therapeutic agents. As a hydrochloride salt, it is generally more stable and easier to handle than its free base form. The compound's molecular structure contributes to its properties, including its potential interactions with biological targets, which may be explored in drug development. Safety and handling precautions should be observed, as with any chemical substance, particularly those with potential biological activity.
Formula:C9H11ClN2O2
InChI:InChI=1/C9H10N2O2.ClH/c12-11(13)9-2-1-7-3-4-10-6-8(7)5-9;/h1-2,5,10H,3-4,6H2;1H
SMILES:c1cc(cc2CNCCc12)N(=O)=O.Cl
Synonyms:- 7-Nitro-1,2,3,4-tetrahydroisoquinoline hydrochloride
- 1,2,3,4-Tetrahydro-7-Nitroisoquinoline Hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
7-Nitro-1,2,3,4-tetrahydroisoquinoline hydrochloride
CAS:Formula:C9H11ClN2O2Purity:97%Color and Shape:SolidMolecular weight:214.64887-Nitro-1,2,3,4-tetrahydroisoquinoline hydrochloride
CAS:7-Nitro-1,2,3,4-tetrahydroisoquinoline hydrochloridePurity:99%Molecular weight:214.65g/mol7-Nitro-1,2,3,4-tetrahydroisoquinoline hydrochloride
CAS:Formula:C9H11ClN2O2Purity:95%Color and Shape:SolidMolecular weight:214.657-Nitro-1,2,3,4-tetrahydroisoquinoline hydrochloride, 97+%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C9H10N2O2•HClPurity:97+%Molecular weight:214.65



