CAS 994-29-6
:Ethanaminium, N,N-diethyl-N-methyl-, iodide (1:1)
Description:
Ethanaminium, N,N-diethyl-N-methyl-, iodide (1:1), commonly referred to as a quaternary ammonium compound, is characterized by its structure, which includes a central nitrogen atom bonded to three alkyl groups: two ethyl groups and one methyl group, along with an iodide counterion. This compound is typically a white to off-white solid or crystalline substance that is soluble in polar solvents, such as water and alcohols, due to its ionic nature. It exhibits properties typical of quaternary ammonium salts, including surface-active behavior, making it useful in various applications such as surfactants, disinfectants, and in the formulation of pharmaceuticals. The presence of the iodide ion contributes to its stability and solubility. Additionally, it may exhibit antimicrobial properties, which can be advantageous in medical and industrial applications. Safety data should be consulted, as quaternary ammonium compounds can pose health risks if not handled properly, including potential skin and respiratory irritation.
Formula:C7H18N·I
InChI:InChI=1S/C7H18N.HI/c1-5-8(4,6-2)7-3;/h5-7H2,1-4H3;1H/q+1;/p-1
InChI key:InChIKey=NDPWCNORTYFYDW-UHFFFAOYSA-M
SMILES:[N+](CC)(CC)(CC)C.[I-]
Synonyms:- Methyltriethylammonium iodide
- Ethanaminium, N,N-diethyl-N-methyl-, iodide
- Ethanaminium, N,N-diethyl-N-methyl-, iodide (1:1)
- Triethylmethylammonium iodide
- Methyltriethylammonium iodide
- Ammonium, triethylmethyl-, odide
- Ethanaminium, N,N-diethyl-N-methyl-, iodide
- N,N-diethyl-N-methylethanaminium iodide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
