CAS 994-71-8
:Bis(tri-n-butylstannyl)acetylene
Description:
Bis(tri-n-butylstannyl)acetylene is an organotin compound characterized by its unique structure, which features two tri-n-butylstannyl groups attached to an acetylene backbone. This compound is typically a colorless to pale yellow liquid and is known for its relatively low volatility and high stability under ambient conditions. It exhibits significant solubility in organic solvents, making it useful in various chemical applications. The presence of tin atoms contributes to its reactivity, particularly in organometallic chemistry, where it can participate in coupling reactions and serve as a precursor for the synthesis of more complex organotin compounds. Additionally, due to the bulky tri-n-butyl groups, the compound may exhibit steric hindrance, influencing its reactivity and interactions with other chemical species. Bis(tri-n-butylstannyl)acetylene is also of interest in materials science, particularly in the development of polymers and other materials that leverage its unique properties. However, safety precautions should be taken when handling organotin compounds due to potential toxicity and environmental concerns associated with tin-based materials.
Formula:C26H54Sn2
InChI:InChI=1/6C4H9.C2.2Sn/c6*1-3-4-2;1-2;;/h6*1,3-4H2,2H3;;;/rC26H54Sn2/c1-7-13-19-27(20-14-8-2,21-15-9-3)25-26-28(22-16-10-4,23-17-11-5)24-18-12-6/h7-24H2,1-6H3
SMILES:CCCC[Sn](CCCC)(CCCC)C#C[Sn](CCCC)(CCCC)CCCC
Synonyms:- Bis(tributylstannyl)acetylene
- Bistrinbutylstannylacetylene
- Ethyne-1,2-Diylbis(Tributylstannane)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Bis(Tri-N-Butylstannyl)Acetylene
CAS:Formula:C26H54Sn2Purity:95%Color and Shape:LiquidMolecular weight:604.1270Bis(tributylstannyl)acetylene
CAS:Bis(tributylstannyl)acetylenePurity:≥95%Color and Shape:LiquidMolecular weight:604.13g/molBis(tributylstannyl)acetylene
CAS:Controlled ProductBis(tributylstannyl)acetylene is a conjugate of ethynyltributyltin and zirconium dichloride. Terminal alkynes are converted to the corresponding acetylenes in the presence of trifluoroacetic acid, chloroformate, or a Grignard reagent. These reaction conditions allow for the synthesis of various acetylenes with different substituents at the terminal carbon atom. Bis(tributylstannyl)acetylene reacts with pyridazine and ethynylation agents to form new compounds that have been characterized by NMR spectroscopy.END>Formula:C26H54Sn2Purity:Min. 95%Molecular weight:604.14 g/mol


