CAS 994-79-6
:Tetrabutylsilane
Description:
Tetrabutylsilane, with the CAS number 994-79-6, is an organosilicon compound characterized by its four butyl groups attached to a silicon atom. It is a colorless, viscous liquid that is typically non-polar and hydrophobic, making it soluble in organic solvents but insoluble in water. Tetrabutylsilane is known for its low volatility and relatively high boiling point, which contributes to its stability under various conditions. It is often used as a reagent in organic synthesis, particularly in the field of organosilicon chemistry, where it serves as a precursor for the preparation of silanes and siloxanes. Additionally, it can act as a reducing agent in certain chemical reactions. Due to its structure, tetrabutylsilane can also function as a surfactant or a lubricant in various applications. Safety considerations include its flammability and potential health hazards upon inhalation or skin contact, necessitating appropriate handling and storage measures.
Formula:C16H36Si
InChI:InChI=1S/C16H36Si/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4/h5-16H2,1-4H3
InChI key:InChIKey=REWDXIKKFOQRID-UHFFFAOYSA-N
SMILES:[Si](CCCC)(CCCC)(CCCC)CCCC
Synonyms:- Silane, tetrabutyl-
- Tetrabutylsilane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.