CAS 99420-75-4
:5-methylpyrimidine-2-carboxylic acid
Description:
5-Methylpyrimidine-2-carboxylic acid is an organic compound characterized by its pyrimidine ring structure, which features a methyl group at the 5-position and a carboxylic acid functional group at the 2-position. This compound is a derivative of pyrimidine, a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of the carboxylic acid group contributes to its acidic properties, making it soluble in polar solvents. It is often used in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. The compound may exhibit biological activity, potentially influencing various biochemical pathways due to its structural similarity to nucleobases. Its melting point, boiling point, and specific reactivity can vary based on environmental conditions and the presence of other functional groups. Safety data should be consulted for handling and storage, as with any chemical substance. Overall, 5-methylpyrimidine-2-carboxylic acid is a valuable compound in both research and industrial applications.
Formula:C6H6N2O2
InChI:InChI=1/C6H6N2O2/c1-4-2-7-5(6(9)10)8-3-4/h2-3H,1H3,(H,9,10)
SMILES:Cc1cnc(C(=O)O)nc1
Synonyms:- 2-Pyrimidinecarboxylic Acid, 5-Methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Methylpyrimidine-2-carboxylic acid, 98%
CAS:Formula:C6H6N2O2Purity:98%Color and Shape:White to Yellow SolidMolecular weight:138.125-METHYLPYRIMIDINE-2-CARBOXYLIC ACID
CAS:Formula:C6H6N2O2Purity:97%Color and Shape:SolidMolecular weight:138.12405-Methylpyrimidine-2-carboxylic acid
CAS:5-Methylpyrimidine-2-carboxylic acidPurity:95%Color and Shape:SolidMolecular weight:138.12g/mol5-Methylpyrimidine-2-carboxylic acid
CAS:Formula:C6H6N2O2Purity:98%Color and Shape:SolidMolecular weight:138.1265-Methylpyrimidine-2-carboxylic acid
CAS:Please enquire for more information about 5-Methylpyrimidine-2-carboxylic acid including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C6H6N2O2Purity:Min. 95%Molecular weight:138.12 g/mol




