
CAS 99422-74-9
:N-(7-Hydroxy-4-methyl-2-oxo-2H-1-benzopyran-8-yl)hexadecanamide
Description:
N-(7-Hydroxy-4-methyl-2-oxo-2H-1-benzopyran-8-yl)hexadecanamide, with the CAS number 99422-74-9, is a synthetic compound characterized by its complex structure, which includes a benzopyran moiety and a long-chain fatty acid amide. This compound features a hydroxyl group and a ketone, contributing to its potential biological activity. The presence of the hexadecanamide chain suggests that it may exhibit amphiphilic properties, allowing it to interact with both hydrophilic and hydrophobic environments. Such characteristics may influence its solubility, stability, and interaction with biological membranes. The benzopyran structure is often associated with various pharmacological activities, including antioxidant and anti-inflammatory effects. Additionally, the compound's unique functional groups may facilitate interactions with specific biological targets, making it of interest in medicinal chemistry and drug development. Overall, N-(7-Hydroxy-4-methyl-2-oxo-2H-1-benzopyran-8-yl)hexadecanamide represents a fascinating subject for further research in the fields of biochemistry and pharmacology.
Formula:C26H39NO4
InChI:InChI=1S/C26H39NO4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-23(29)27-25-22(28)18-17-21-20(2)19-24(30)31-26(21)25/h17-19,28H,3-16H2,1-2H3,(H,27,29)
InChI key:InChIKey=BBPGIOUAIMWZKI-UHFFFAOYSA-N
SMILES:N(C(CCCCCCCCCCCCCCC)=O)C1=C2C(=CC=C1O)C(C)=CC(=O)O2
Synonyms:- Hexadecanamide, N-(7-hydroxy-4-methyl-2-oxo-2H-1-benzopyran-8-yl)-
- N-(7-Hydroxy-4-methyl-2-oxo-2H-1-benzopyran-8-yl)hexadecanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.