CymitQuimica logo

CAS 99429-64-8

:

ethyl 4-chloro-2-oxo-1,2-dihydroquinoline-3-carboxylate

Description:
Ethyl 4-chloro-2-oxo-1,2-dihydroquinoline-3-carboxylate is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound. This substance features a chloro substituent at the 4-position and a carboxylate group at the 3-position, contributing to its reactivity and potential applications in organic synthesis. The presence of the ethyl ester group enhances its solubility in organic solvents, making it useful in various chemical reactions. The compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its unique structure allows for potential biological activity, which may be explored in medicinal chemistry. Additionally, the compound's properties, such as melting point, boiling point, and solubility, can vary based on purity and environmental conditions. As with many chemical substances, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards. Overall, ethyl 4-chloro-2-oxo-1,2-dihydroquinoline-3-carboxylate is of interest for its synthetic utility and potential pharmacological applications.
Formula:C12H10ClNO3
InChI:InChI=1/C12H10ClNO3/c1-2-17-12(16)9-10(13)7-5-3-4-6-8(7)14-11(9)15/h3-6H,2H2,1H3,(H,14,15)
InChI key:KTFCVAZGXKEUSN-UHFFFAOYSA-N
SMILES:CCOC(=O)c1c(c2ccccc2nc1O)Cl
Synonyms:
  • 3-Quinolinecarboxylic acid, 4-chloro-1,2-dihydro-2-oxo-, ethyl ester
  • 3-Quinolinecarboxylic Acid, 4-Chloro-2-Hydroxy-, Ethyl Ester
  • Ethyl 4-chloro-2-oxo-1,2-dihydroquinoline-3-carboxylate
Found 6 products.