CymitQuimica logo

CAS 99446-40-9

:

Ethyl 5-phenylpyrazolo[1,5-a]pyridine-3-carboxylate

Description:
Ethyl 5-phenylpyrazolo[1,5-a]pyridine-3-carboxylate is a chemical compound characterized by its unique pyrazolo-pyridine structure, which combines elements of both pyrazole and pyridine rings. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents such as ethanol and dimethyl sulfoxide (DMSO), but may have limited solubility in water. Its molecular structure includes an ethyl ester functional group, contributing to its reactivity and potential applications in organic synthesis. Ethyl 5-phenylpyrazolo[1,5-a]pyridine-3-carboxylate is of interest in medicinal chemistry due to its potential biological activities, which may include anti-inflammatory or anticancer properties, although specific biological data may vary. As with many organic compounds, handling should be done with care, following appropriate safety protocols to mitigate risks associated with chemical exposure. Overall, this compound represents a valuable scaffold for further research and development in pharmaceutical applications.
Formula:C16H14N2O2
InChI:InChI=1S/C16H14N2O2/c1-2-20-16(19)14-11-17-18-9-8-13(10-15(14)18)12-6-4-3-5-7-12/h3-11H,2H2,1H3
InChI key:InChIKey=QSTFAUBSGZTJKW-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C2N(N=C1)C=CC(=C2)C3=CC=CC=C3
Synonyms:
  • Ethyl 5-phenylpyrazolo[1,5-a]pyridine-3-carboxylate
  • Pyrazolo[1,5-a]pyridine-3-carboxylic acid, 5-phenyl-, ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.