CymitQuimica logo

CAS 99457-12-2

:

2-acetyl-3-[(3-amino-2,3,6-trideoxyhexopyranosyl)oxy]-5,12-dihydroxy-6,11-dioxo-1,2,3,4,6,11-hexahydrotetracen-2-yl 3-amino-2,3,6-trideoxyhexopyranoside dihydrochloride

Description:
The chemical substance known as "2-acetyl-3-[(3-amino-2,3,6-trideoxyhexopyranosyl)oxy]-5,12-dihydroxy-6,11-dioxo-1,2,3,4,6,11-hexahydrotetracen-2-yl 3-amino-2,3,6-trideoxyhexopyranoside dihydrochloride," with the CAS number 99457-12-2, is a complex organic compound characterized by its intricate structure, which includes multiple functional groups such as hydroxyl (-OH), amino (-NH2), and acetyl (-C(=O)CH3) groups. This compound features a tetracene backbone, which contributes to its potential biological activity and interaction with various biological systems. The presence of trideoxyhexopyranosyl units suggests that it may exhibit glycosidic properties, potentially influencing its solubility and reactivity. The dihydrochloride form indicates that it is a salt, which may enhance its stability and solubility in aqueous environments. Overall, this compound may have applications in medicinal chemistry, particularly in the development of therapeutics, due to its unique structural characteristics and potential bioactivity.
Formula:C32H40Cl2N2O11
InChI:InChI=1/C32H38N2O11.2ClH/c1-12-26(36)19(33)9-22(42-12)44-21-8-17-18(11-32(21,14(3)35)45-23-10-20(34)27(37)13(2)43-23)31(41)25-24(30(17)40)28(38)15-6-4-5-7-16(15)29(25)39;;/h4-7,12-13,19-23,26-27,36-37,40-41H,8-11,33-34H2,1-3H3;2*1H
SMILES:CC1C(C(CC(O1)OC1Cc2c(CC1(C(=O)C)OC1CC(C(C(C)O1)O)N)c(c1c(C(=O)c3ccccc3C1=O)c2O)O)N)O.Cl.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.