CAS 99459-49-1

3-Amino-4-hydroxy-2(1H)-quinolinone

Description:

3-Amino-4-hydroxy-2(1H)-quinolinone, with the CAS number 99459-49-1, is an organic compound characterized by its quinolinone structure, which features a fused bicyclic system containing both a benzene and a pyridine ring. This compound possesses an amino group (-NH2) and a hydroxy group (-OH) at specific positions on the quinolinone ring, contributing to its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the hydroxyl group. The compound is of interest in various fields, including medicinal chemistry, due to its potential pharmacological properties, such as antimicrobial or antitumor activities. Its structural features allow for various chemical modifications, which can enhance its biological efficacy or alter its physicochemical properties. As with many quinolinone derivatives, it may also participate in hydrogen bonding and other intermolecular interactions, influencing its behavior in biological systems and chemical reactions.

Formula: C₉H₈N₂O₂

InChI: InChI=1S/C9H8N2O2/c10-7-8(12)5-3-1-2-4-6(5)11-9(7)13/h1-4H,10H2,(H2,11,12,13)

InChI key: InChIKey=RCIFCIDCUXFWPA-UHFFFAOYSA-N

SMILES: OC=1C=2C(NC(=O)C1N)=CC=CC2

Synonyms:

• 2,4-Quinolinediol, 3-amino-
• 2(1H)-Quinolinone, 3-amino-4-hydroxy-
• 3-Amino-4-hydroxy-2(1H)-quinolinone
• 3-Amino-4-hydroxy-1,2-dihydroquinolin-2-one
• 3-Aminoquinoline-2,4-diol