CAS 99464-82-1

Carbonic acid, 1-chloroethyl propyl ester

Description:

Carbonic acid, 1-chloroethyl propyl ester, also known by its CAS number 99464-82-1, is an organic compound that belongs to the class of carbonic acid esters. This substance features a carbonic acid moiety where one of the hydroxyl groups is replaced by a 1-chloroethyl propyl group, which contributes to its unique properties. It is typically a colorless to pale yellow liquid with a characteristic odor. The compound is known for its moderate volatility and solubility in organic solvents, while being less soluble in water. Its chemical structure allows it to participate in various chemical reactions, making it useful in synthetic organic chemistry. Additionally, it may exhibit properties such as being a potential solvent or intermediate in the production of other chemicals. Safety data should be consulted, as it may pose health risks if inhaled or ingested, and appropriate handling precautions should be taken. Overall, carbonic acid, 1-chloroethyl propyl ester is a versatile compound with applications in various chemical processes.

Formula: C₆H₁₁ClO₃

InChI: InChI=1S/C6H11ClO3/c1-3-4-9-6(8)10-5(2)7/h5H,3-4H2,1-2H3

InChI key: InChIKey=WSMINTWDWKPQQQ-UHFFFAOYSA-N

SMILES: O(C(OCCC)=O)C(C)Cl

Synonyms:

• Carbonic acid, 1-chloroethyl propyl ester
• 1-Chloroethyl propyl carbonate

1-Chloroethyl propyl carbonate

CAS: 99464-82-1

Versatile small molecule scaffold

Formula: C₆H₁₁ClO₃

Purity: Min. 95%

Molecular weight: 166.6 g/mol

Ref: 3D-ZDA46482