
CAS 99465-05-1
:Methyl 6-bromo-2-chloro-3-quinolinecarboxylate
Description:
Methyl 6-bromo-2-chloro-3-quinolinecarboxylate is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a methyl ester functional group, which contributes to its reactivity and solubility properties. The presence of bromine and chlorine substituents on the quinoline ring enhances its potential for various chemical reactions, including electrophilic aromatic substitution and nucleophilic attacks. The compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its molecular structure suggests it may exhibit biological activity, making it of interest in medicinal chemistry. Additionally, the compound's physical properties, such as melting point, boiling point, and solubility, would be influenced by the halogen substituents and the ester group. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks.
Formula:C11H7BrClNO2
InChI:InChI=1S/C11H7BrClNO2/c1-16-11(15)8-5-6-4-7(12)2-3-9(6)14-10(8)13/h2-5H,1H3
InChI key:InChIKey=GACUMWICVHTQMC-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC2=C(N=C1Cl)C=CC(Br)=C2
Synonyms:- 3-Quinolinecarboxylic acid, 6-bromo-2-chloro-, methyl ester
- Methyl 6-bromo-2-chloro-3-quinolinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.