
CAS 99469-78-0
:4-Hydrazinyl-2-methyl-6-(methylthio)pyrimidine
Description:
4-Hydrazinyl-2-methyl-6-(methylthio)pyrimidine is a heterocyclic organic compound characterized by its pyrimidine ring structure, which is substituted at specific positions. The presence of a hydrazinyl group indicates that it contains a hydrazine functional group, contributing to its potential reactivity and biological activity. The methylthio group introduces a sulfur atom into the structure, which can influence the compound's properties, such as solubility and stability. This compound may exhibit various biological activities, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. The compound's CAS number, 99469-78-0, allows for its identification in chemical databases and literature. Overall, 4-Hydrazinyl-2-methyl-6-(methylthio)pyrimidine is notable for its unique functional groups and potential utility in various chemical and biological contexts.
Formula:C6H10N4S
InChI:InChI=1S/C6H10N4S/c1-4-8-5(10-7)3-6(9-4)11-2/h3H,7H2,1-2H3,(H,8,9,10)
InChI key:InChIKey=FQQHRCXWMQXHHB-UHFFFAOYSA-N
SMILES:N(N)=C1C=C(SC)N=C(C)N1
Synonyms:- Pyrimidine, 4-hydrazinyl-2-methyl-6-(methylthio)-
- 1-[2-Methyl-6-(methylthio)pyrimidin-4-yl]hydrazine
- 4(1H)-Pyrimidinone, 2-methyl-6-(methylthio)-, hydrazone
- 4-Hydrazinyl-2-methyl-6-(methylthio)pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.