CAS 99473-73-1
:N-(1-carboxyethyl)-D-methionine
Description:
N-(1-carboxyethyl)-D-methionine, also known by its CAS number 99473-73-1, is an amino acid derivative that features a methionine backbone with a carboxyethyl group attached to the nitrogen atom. This compound is characterized by its polar nature due to the presence of both amino and carboxylic acid functional groups, which contribute to its solubility in water. The structure includes a sulfur atom, which is a hallmark of methionine, imparting unique properties such as the ability to participate in redox reactions. N-(1-carboxyethyl)-D-methionine is of interest in biochemical research, particularly in studies related to protein synthesis and metabolic pathways. Its potential applications may extend to agriculture, nutrition, and pharmaceuticals, where it could play a role in enhancing plant growth or serving as a dietary supplement. As with many amino acid derivatives, its stability and reactivity can be influenced by environmental factors such as pH and temperature, making it a subject of interest for further study in various scientific fields.
Formula:C8H15NO4S
InChI:InChI=1/C8H15NO4S/c1-5(7(10)11)9-6(8(12)13)3-4-14-2/h5-6,9H,3-4H2,1-2H3,(H,10,11)(H,12,13)/t5?,6-/m1/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.