CAS 99487-26-0
:4-(2-fluorophenyl)-6-methyl-2-piperazin-1-ylthieno[2,3-d]pyrimidine hydrochloride
Description:
4-(2-fluorophenyl)-6-methyl-2-piperazin-1-ylthieno[2,3-d]pyrimidine hydrochloride is a chemical compound characterized by its complex structure, which includes a thieno[2,3-d]pyrimidine core, a piperazine moiety, and a fluorophenyl substituent. This compound typically exhibits properties such as solubility in polar solvents, which is common for hydrochloride salts, and may demonstrate biological activity due to its structural features, potentially interacting with various biological targets. The presence of the fluorine atom can enhance lipophilicity and metabolic stability, while the piperazine ring may contribute to its pharmacological profile. The compound's hydrochloride form indicates that it is a salt, which often improves its stability and solubility in aqueous environments. Such characteristics make it of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific receptors or pathways. As with many synthetic compounds, its safety, efficacy, and potential applications would require thorough investigation through experimental studies.
Formula:C17H18ClFN4S
InChI:InChI=1/C17H17FN4S.ClH/c1-11-10-13-15(12-4-2-3-5-14(12)18)20-17(21-16(13)23-11)22-8-6-19-7-9-22;/h2-5,10,19H,6-9H2,1H3;1H
SMILES:Cc1cc2c(c3ccccc3F)nc(nc2s1)N1CCNCC1.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.