CAS 99495-90-6

N-[(2R)-piperidin-2-ylmethyl]-2,5-bis(2,2,2-trifluoroethoxy)benzamide

Description:

N-[(2R)-piperidin-2-ylmethyl]-2,5-bis(2,2,2-trifluoroethoxy)benzamide, with CAS number 99495-90-6, is a synthetic organic compound characterized by its complex structure, which includes a piperidine ring and a benzamide moiety. The presence of two trifluoroethoxy groups enhances its lipophilicity and potentially influences its biological activity. This compound is likely to exhibit significant polar characteristics due to the trifluoromethyl groups, which can affect its solubility and reactivity. The piperidine ring contributes to its basicity and can participate in hydrogen bonding, making it a candidate for various pharmacological applications. Additionally, the compound may exhibit interesting interactions with biological targets due to its unique functional groups. Its synthesis and characterization would typically involve standard organic chemistry techniques, and it may be of interest in medicinal chemistry for its potential therapeutic properties. As with many synthetic compounds, safety and handling precautions are essential due to the presence of fluorinated groups, which can pose environmental and health risks.

Formula: C₁₇H₂₀F₆N₂O₃

InChI: InChI=1/C17H20F6N2O3/c18-16(19,20)9-27-12-4-5-14(28-10-17(21,22)23)13(7-12)15(26)25-8-11-3-1-2-6-24-11/h4-5,7,11,24H,1-3,6,8-10H2,(H,25,26)/t11-/m1/s1

SMILES: C1CCN[C@H](C1)CN=C(c1cc(ccc1OCC(F)(F)F)OCC(F)(F)F)O

Synonyms:

• benzamide, N-[(2R)-2-piperidinylmethyl]-2,5-bis(2,2,2-trifluoroethoxy)-

(R)-Flecainide

CAS: 99495-90-6

Formula: C₁₇H₂₀F₆N₂O₃

Color and Shape: White To Off-White Solid

Molecular weight: 414.35

Ref: 4Z-F-383

R-(-)-Flecainide

Controlled Product

CAS: 99495-90-6

Formula: C₁₇H₂₀F₆N₂O₃

Color and Shape: Neat

Molecular weight: 414.34

Ref: TR-F389990