CymitQuimica logo

CAS 99499-25-9

:

2-chloro-4-(2-fluorophenyl)-6-methyl-thieno[2,3-d]pyrimidine

Description:
2-Chloro-4-(2-fluorophenyl)-6-methyl-thieno[2,3-d]pyrimidine is a heterocyclic compound characterized by its thieno[2,3-d]pyrimidine core, which incorporates both sulfur and nitrogen atoms in its structure. This compound features a chlorine atom at the 2-position and a fluorophenyl group at the 4-position, contributing to its unique chemical properties and potential biological activity. The presence of a methyl group at the 6-position enhances its lipophilicity, which may influence its solubility and permeability in biological systems. The thieno[2,3-d]pyrimidine framework is known for its applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with various biological targets. The compound's molecular structure suggests potential for diverse reactivity, including electrophilic substitution and nucleophilic attack, making it a candidate for further research in drug development and synthesis. Its specific characteristics, such as melting point, boiling point, and spectral data, would require experimental determination or literature reference for precise values.
Formula:C13H8ClFN2S
InChI:InChI=1/C13H8ClFN2S/c1-7-6-9-11(8-4-2-3-5-10(8)15)16-13(14)17-12(9)18-7/h2-6H,1H3
SMILES:Cc1cc2c(c3ccccc3F)nc(Cl)nc2s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.