CAS 99512-09-1

Methyl 3-amino-4-nitrobenzoate

Description:

Methyl 3-amino-4-nitrobenzoate, also known by its CAS number 99512-09-1, is an organic compound that belongs to the class of benzoate esters. It features a methyl ester functional group attached to a benzoic acid derivative, which is further substituted with an amino group and a nitro group at the 3 and 4 positions, respectively. This compound typically appears as a solid or crystalline substance and is characterized by its aromatic structure, which contributes to its chemical stability and reactivity. The presence of the amino group imparts basic properties, while the nitro group is known for its electron-withdrawing effects, influencing the compound's reactivity in various chemical reactions. Methyl 3-amino-4-nitrobenzoate may be utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its potential as an intermediate in the synthesis of more complex molecules. Safety and handling precautions should be observed, as with many nitro compounds, due to potential toxicity and environmental concerns.

Formula: C₈H₈N₂O₄

InChI: InChI=1/C8H8N2O4/c1-14-8(11)5-2-3-7(10(12)13)6(9)4-5/h2-4H,9H2,1H3

SMILES: COC(=O)c1ccc(c(c1)N)N(=O)=O

Synonyms:

• Benzoic acid, 3-amino-4-nitro-, methyl ester

Methyl 3-amino-4-nitrobenzoate

CAS: 99512-09-1

Formula: C₈H₈N₂O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 196.1601

Ref: IN-DA005S25

Methyl 3-amino-4-nitrobenzoate

CAS: 99512-09-1

Methyl 3-amino-4-nitrobenzoate

Purity: 95%

Molecular weight: 196.16g/mol

Ref: 54-OR61359

Methyl 3-Amino-4-nitrobenzoate

CAS: 99512-09-1

Formula: C₈H₈N₂O₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 196.162

Ref: 10-F042911