CAS 99528-42-4
:(S)-(-)-1-(4-chlorophenyl)-1-ethanol
Description:
(S)-(-)-1-(4-chlorophenyl)-1-ethanol, with the CAS number 99528-42-4, is a chiral organic compound characterized by its specific stereochemistry, which is denoted by the (S) configuration. This compound features a phenyl group substituted with a chlorine atom at the para position, contributing to its unique chemical properties. The presence of the hydroxyl (-OH) group indicates that it is an alcohol, which can participate in hydrogen bonding, influencing its solubility and reactivity. The chlorophenyl moiety enhances the compound's hydrophobic characteristics while also potentially affecting its biological activity. As a chiral molecule, it may exhibit different pharmacological effects depending on its stereoisomerism, making it of interest in medicinal chemistry. The compound's physical properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and the presence of other solvents or reagents. Overall, (S)-(-)-1-(4-chlorophenyl)-1-ethanol is significant in various chemical and pharmaceutical applications due to its structural features and stereochemical properties.
Formula:C8H9ClO
InChI:InChI=1/C8H9ClO/c1-6(10)7-2-4-8(9)5-3-7/h2-6,10H,1H3/t6-/m0/s1
SMILES:C[C@@H](c1ccc(cc1)Cl)O
Synonyms:- (S)-4-Chloro-Alpha-Methylbenzyl Alcohol
- (S)-4-Chloro-1-phenylethanol
- (1S)-1-(4-chlorophenyl)ethanol
- (S)-1-(4-Chloro-phenyl)-ethanol
- S-1-(4-Chloro)phenethyl Alcohol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(S)-1-(4-Chlorophenyl)ethanol
CAS:Formula:C8H9ClOPurity:97%Color and Shape:LiquidMolecular weight:156.6095(S)-4-Chloro-α-methylbenzyl alcohol
CAS:(S)-4-Chloro-α-methylbenzyl alcoholPurity:98%Molecular weight:156.61g/mol(S)-1-(4-Chlorophenyl)ethanol
CAS:Formula:C8H9ClOPurity:95%Color and Shape:LiquidMolecular weight:156.61(S)-4-Chloro-alpha-methylbenzyl alcohol
CAS:(S)-4-Chloro-alpha-methylbenzyl alcohol is a versatile compound with multiple applications. It has antiviral properties and can inhibit the replication of certain viruses. Additionally, it acts as an intermediate in the synthesis of various bioactive compounds, including synthetic cannabinoids. This compound is water-soluble and can be easily incorporated into different formulations. (S)-4-Chloro-alpha-methylbenzyl alcohol also exhibits antioxidant activity and may have potential health benefits due to its ability to scavenge free radicals. Its unique chemical structure makes it suitable for research purposes and as a building block in the development of novel drugs or functional materials.Formula:C8H9ClOPurity:Min. 95%Molecular weight:156.61 g/mol



