CAS 99532-53-3

1-(5-Fluoro-1H-indol-3-yl)ethanone

Description:

1-(5-Fluoro-1H-indol-3-yl)ethanone, with the CAS number 99532-53-3, is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a fluorine atom at the 5-position of the indole ring contributes to its unique chemical properties, potentially influencing its reactivity and biological activity. The ethanone functional group indicates that it contains a carbonyl group (C=O) adjacent to an ethyl group, which can participate in various chemical reactions, such as nucleophilic additions. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry and drug development. Its solubility, stability, and reactivity can vary depending on the solvent and conditions used. Additionally, the fluorine substitution can enhance lipophilicity and metabolic stability, which are important factors in drug design. Overall, 1-(5-Fluoro-1H-indol-3-yl)ethanone is a compound with potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₁₀H₈FNO

InChI: InChI=1S/C10H8FNO/c1-6(13)9-5-12-10-3-2-7(11)4-8(9)10/h2-5,12H,1H3

InChI key: InChIKey=FYSYTQMPBWFSBB-UHFFFAOYSA-N

SMILES: C(C)(=O)C=1C=2C(NC1)=CC=C(F)C2

Synonyms:

• 3-Acetyl-5-fluoroindole
• 1-(5-Fluoro-1H-indol-3-yl)ethanone
• Ethanone, 1-(5-fluoro-1H-indol-3-yl)-
• 1-(5-Fluoro-1H-indol-3-yl)ethan-1-one