CAS 99534-03-9
:protein kinase inhibitor rabbit*sequence
Description:
The chemical substance known as "protein kinase inhibitor rabbit*sequence" with the CAS number 99534-03-9 is a synthetic compound designed to inhibit protein kinases, which are enzymes that play a crucial role in various cellular processes, including signal transduction, cell division, and metabolism. This inhibitor is often utilized in research to study the mechanisms of kinase activity and its implications in diseases such as cancer. The compound typically exhibits specificity towards certain kinase targets, allowing for the modulation of signaling pathways. Its effectiveness can be influenced by factors such as concentration, the presence of other cellular components, and the specific kinase isoform being targeted. Inhibitors like this one are valuable tools in drug discovery and development, as they can help elucidate the role of kinases in disease progression and aid in the identification of potential therapeutic strategies. Additionally, safety and toxicity profiles are essential considerations when working with such compounds in both laboratory and clinical settings.
Formula:C94H148N32O31
InChI:InChI=1/C94H148N32O31/c1-11-42(3)70(124-85(150)58(31-50-19-14-13-15-20-50)117-84(149)61(35-67(135)136)116-74(139)44(5)110-81(146)57(32-51-24-26-53(131)27-25-51)119-90(155)73(49(10)130)126-86(151)69(96)47(8)128)88(153)112-45(6)75(140)122-63(40-127)77(142)107-38-65(133)114-55(22-17-29-105-93(99)100)80(145)125-72(48(9)129)87(152)108-39-66(134)113-54(21-16-28-104-92(97)98)78(143)115-56(23-18-30-106-94(101)102)79(144)118-60(34-64(95)132)82(147)111-46(7)76(141)123-71(43(4)12-2)89(154)120-59(33-52-37-103-41-109-52)83(148)121-62(91(156)157)36-68(137)138/h13-15,19-20,24-27,37,41-49,54-63,69-73,127-131H,11-12,16-18,21-23,28-36,38-40,96H2,1-10H3,(H2,95,132)(H,103,109)(H,107,142)(H,108,152)(H,110,146)(H,111,147)(H,112,153)(H,113,134)(H,114,133)(H,115,143)(H,116,139)(H,117,149)(H,118,144)(H,119,155)(H,120,154)(H,121,148)(H,122,140)(H,123,141)(H,124,150)(H,125,145)(H,126,151)(H,135,136)(H,137,138)(H,156,157)(H4,97,98,104)(H4,99,100,105)(H4,101,102,106)
SMILES:CCC(C)C(C(=NC(C)C(=NC(CO)C(=NCC(=NC(CCCNC(=N)N)C(=NC(C(C)O)C(=NCC(=NC(CCCNC(=N)N)C(=NC(CCCNC(=N)N)C(=NC(CC(=N)O)C(=NC(C)C(=NC(C(C)CC)C(=NC(Cc1cnc[nH]1)C(=NC(CC(=O)O)C(=O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)N=C(C(Cc1ccccc1)N=C(C(CC(=O)O)N=C(C(C)N=C(C(Cc1ccc(cc1)O)N=C(C(C(C)O)N=C(C(C(C)O)N)O)O)O)O)O)O
Synonyms:- Protein Kinase A Inhibitor 5-24
- H-Thr-Thr-Tyr-Ala-Asp-Phe-Ile-Ala-Ser-Gly-Arg-Thr-Gly-Arg-Arg-Asn-Ala-Ile-His-Asp-OH
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
cAMP Dependent Protein Kinase Inhibitor (PKI 5-24)
CAS:<p>For cellular and molecular biology applications</p>Formula:C94H148N32O31Molecular weight:2222.4PKI(5-24)
CAS:<p>High affinity PKA inhibitor (Ki = 2.3 nM).</p>Formula:C76H129N31O28Purity:98%Color and Shape:SolidMolecular weight:1925.057PKI (5-24)
CAS:<p>PKI (5-24) is a synthetic peptide specifically designed as a protein kinase inhibitor. Derived from a segment of the endogenous PKA inhibitor protein, this peptide is utilized to inhibit the activity of cyclic AMP-dependent protein kinase (PKA). The sequence corresponds to amino acids 5-24 of the native protein, retaining its potent inhibitory activity. PKI (5-24) functions by binding to the catalytic subunit of PKA, thus preventing the phosphorylation of downstream targets.</p>Formula:C94H148N32O31Purity:Min. 95%Molecular weight:2,222.4 g/mol





