CymitQuimica logo

CAS 99541-29-4

:

1,1,1-trifluoro-3-[(4-sulfanylbutyl)sulfanyl]propan-2-one

Description:
1,1,1-Trifluoro-3-[(4-sulfanylbutyl)sulfanyl]propan-2-one, with the CAS number 99541-29-4, is a chemical compound characterized by its unique structure that includes trifluoromethyl and thioether functional groups. The presence of trifluoromethyl groups typically imparts significant lipophilicity and can enhance the compound's biological activity. The thioether moiety, derived from the sulfanylbutyl group, suggests potential reactivity and interactions in biological systems, particularly in the context of drug design or synthesis. This compound may exhibit properties such as moderate to high stability under standard conditions, but its reactivity can vary depending on the surrounding environment and functional groups present. Additionally, the trifluoromethyl group can influence the compound's polarity and solubility in various solvents. Overall, the combination of these functional groups may lead to interesting applications in pharmaceuticals, agrochemicals, or materials science, although specific applications would depend on further research into its biological and chemical behavior.
Formula:C7H11F3OS2
InChI:InChI=1/C7H11F3OS2/c8-7(9,10)6(11)5-13-4-2-1-3-12/h12H,1-5H2
SMILES:C(CCSCC(=O)C(F)(F)F)CS
Synonyms:
  • 1,1,1-Trifluoro-3-((4-mercaptobutyl)thio)-2-propanone
  • 2-Propanone, 1,1,1-trifluoro-3-((4-mercaptobutyl)thio)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.