CAS 99541-30-7
:3-[(4-butylphenyl)sulfanyl]-1,1,1-trifluoropropan-2-one
Description:
3-[(4-butylphenyl)sulfanyl]-1,1,1-trifluoropropan-2-one, identified by its CAS number 99541-30-7, is an organic compound characterized by the presence of a trifluoropropanone moiety and a butylphenyl sulfide group. This compound features a trifluoromethyl group, which imparts unique electronic properties and enhances lipophilicity, making it potentially useful in various chemical applications. The butylphenyl group contributes to its hydrophobic characteristics, while the sulfanyl functional group introduces reactivity that can be exploited in synthetic chemistry. The presence of the trifluoromethyl group often enhances the compound's stability and can influence its biological activity. As with many organofluorine compounds, it may exhibit distinct physical properties such as altered boiling and melting points compared to non-fluorinated analogs. The compound's structure suggests potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis, although specific applications would depend on further research into its reactivity and biological interactions. Safety and handling precautions should be observed due to the presence of sulfur and fluorine in its structure.
Formula:C13H15F3OS
InChI:InChI=1/C13H15F3OS/c1-2-3-4-10-5-7-11(8-6-10)18-9-12(17)13(14,15)16/h5-8H,2-4,9H2,1H3
SMILES:CCCCc1ccc(cc1)SCC(=O)C(F)(F)F
Synonyms:- 2-Propanone, 3-((4-butylphenyl)thio)-1,1,1-trifluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.