
CAS 99548-73-9
:1-(3-Bromophenyl)-1-hydroxy-2-propanone
Description:
1-(3-Bromophenyl)-1-hydroxy-2-propanone, with the CAS number 99548-73-9, is an organic compound characterized by its unique structure, which includes a bromophenyl group and a hydroxy ketone functional group. This compound typically appears as a solid or crystalline substance and is known for its potential applications in organic synthesis and medicinal chemistry. The presence of the bromine atom enhances its reactivity, making it a useful intermediate in various chemical reactions, including electrophilic aromatic substitution and nucleophilic addition. The hydroxy group contributes to its solubility in polar solvents and can participate in hydrogen bonding, influencing its physical properties and reactivity. Additionally, the compound may exhibit biological activity, which warrants further investigation for potential pharmaceutical applications. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks or environmental hazards.
Formula:C9H9BrO2
InChI:InChI=1S/C9H9BrO2/c1-6(11)9(12)7-3-2-4-8(10)5-7/h2-5,9,12H,1H3
InChI key:InChIKey=YXFNGSXBRLRUFX-UHFFFAOYSA-N
SMILES:C(C(C)=O)(O)C1=CC(Br)=CC=C1
Synonyms:- 2-Propanone, 1-(3-bromophenyl)-1-hydroxy-
- 1-(3-Bromophenyl)-1-hydroxy-2-propanone
- 1-(3-Bromo-phenyl)-1-hydroxy-acetone
- 2-Propanone, 1-(m-bromophenyl)-1-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.