CAS 99552-37-1

(1S,3S,5S,6S,8R,10R,11S,13R,15R,16S,18R,20R,21S,23R,25R,26S,30R,31S,33R,35R,36R,37R,38R,39R,40R,41R,42R,43R,44R,45R,46R,47R,48R,49R)-5-(fluoromethyl)-10,15,20,25,30,35-hexakis(hydroxymethyl)-2,4,7,9,12,14,17,19,22,24,27,29,32,34-tetradecaoxaoctacyclo[31.2

Description:

The chemical substance with the name provided is a complex organic molecule characterized by a highly intricate structure featuring multiple stereocenters and functional groups. It contains a fluoromethyl group, which introduces a fluorine atom into the molecular framework, potentially influencing its reactivity and biological activity. The presence of numerous hydroxymethyl groups suggests that the compound may exhibit significant hydrogen-bonding capabilities, which can enhance solubility in polar solvents and may affect its interaction with biological targets. The extensive oxo- and cyclo- structures indicate a high degree of molecular complexity, which could contribute to unique physical and chemical properties, such as stability and conformational flexibility. This compound may have applications in medicinal chemistry, particularly in drug design, due to its potential bioactivity stemming from its structural features. However, the specific properties, such as melting point, boiling point, and solubility, would require empirical measurement or detailed computational analysis to ascertain.

Formula: C₄₂H₆₉FO₃₄

InChI: InChI=1/C42H69FO34/c43-1-8-29-15(50)22(57)36(64-8)72-30-9(2-44)66-38(24(59)17(30)52)74-32-11(4-46)68-40(26(61)19(32)54)76-34-13(6-48)70-42(28(63)21(34)56)77-35-14(7-49)69-41(27(62)20(35)55)75-33-12(5-47)67-39(25(60)18(33)53)73-31-10(3-45)65-37(71-29)23(58)16(31)51/h8-42,44-63H,1-7H2/t8-,9-,10-,11-,12-,13-,14-,15-,16-,17-,18-,19-,20-,21-,22-,23-,24-,25-,26-,27-,28-,29-,30-,31-,32-,33-,34-,35-,36-,37-,38-,39-,40?,41-,42-/m1/s1

SMILES: C([C@@H]1[C@@H]2[C@@H]([C@H]([C@H](O1)O[C@@H]1[C@@H](CO)O[C@@H]([C@@H]([C@H]1O)O)O[C@@H]1[C@@H](CO)OC([C@@H]([C@H]1O)O)O[C@@H]1[C@@H](CO)O[C@@H]([C@@H]([C@H]1O)O)O[C@@H]1[C@@H](CO)O[C@@H]([C@@H]([C@H]1O)O)O[C@@H]1[C@@H](CO)O[C@@H]([C@@H]([C@H]1O)O)O[C@@H]1[C@@H](CO)O[C@@H]([C@@H]([C@H]1O)O)O2)O)O)F

6-Deoxy-6-Fluorocyclomaltoheptaose

CAS: 99552-37-1

The 6-deoxy-6-fluorocyclomaltoheptaose is a low molecular weight compound that has been found to have anti-amylase activity. This substance is characterized by its chromatographic techniques, which can be used to identify the chemical structure of the molecule. The 6-deoxy-6-fluorocyclomaltoheptaose has been found to consist of an amylase inhibitor and an enzyme substrate. It exhibits specificity for the catalytic site of amylase, which is located in subsite 1, and it attacks this substrate at the 6-position of glucose. This substance is not as potent as other amylase inhibitors such as d-glucose, but it does show greater specificity for amylase than other substances with similar structures.

Formula: C₄₂H₆₉FO₃₄

Purity: Min. 95%

Molecular weight: 1,136.98 g/mol

Ref: 3D-OD81686