CAS 99556-74-8
:3-methoxy-4-[2-(pyrrolidin-1-yl)ethoxy]benzaldehyde
Description:
3-Methoxy-4-[2-(pyrrolidin-1-yl)ethoxy]benzaldehyde is an organic compound characterized by its aromatic structure, which includes a methoxy group and an aldehyde functional group. The presence of the pyrrolidine moiety suggests that it has potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to the nitrogen-containing heterocycle that can interact with biological targets. This compound is likely to exhibit moderate solubility in organic solvents and may have limited solubility in water, typical of many aromatic aldehydes. Its molecular structure indicates potential reactivity, especially in nucleophilic addition reactions due to the aldehyde group. Additionally, the methoxy group can influence the electronic properties of the aromatic ring, potentially affecting its reactivity and interaction with other molecules. Safety data and handling precautions should be considered, as with any chemical substance, particularly regarding its potential toxicity and environmental impact. Overall, 3-methoxy-4-[2-(pyrrolidin-1-yl)ethoxy]benzaldehyde represents a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C14H19NO3
InChI:InChI=1/C14H19NO3/c1-17-14-10-12(11-16)4-5-13(14)18-9-8-15-6-2-3-7-15/h4-5,10-11H,2-3,6-9H2,1H3
SMILES:COc1cc(ccc1OCCN1CCCC1)C=O
Synonyms:- Benzaldehyde, 3-Methoxy-4-[2-(1-Pyrrolidinyl)Ethoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.