CAS 99566-27-5
:phe-leu-phe-gln-pro-gln-arg-phe amide
Description:
The chemical substance known as "phe-leu-phe-gln-pro-gln-arg-phe amide," with the CAS number 99566-27-5, is a synthetic peptide composed of a sequence of amino acids. This peptide features phenylalanine (Phe), leucine (Leu), glutamine (Gln), proline (Pro), arginine (Arg), and is characterized by its amide terminal, which can influence its stability and solubility. Peptides like this one often exhibit specific biological activities, potentially acting as signaling molecules or having roles in various physiological processes. The presence of aromatic amino acids, such as phenylalanine, may contribute to hydrophobic interactions, while the charged side chains from arginine can enhance solubility in aqueous environments. The sequence and structure of this peptide can also affect its conformation and interactions with biological targets, making it of interest in fields such as biochemistry, pharmacology, and biotechnology. Further studies would be necessary to elucidate its specific biological functions and potential applications in therapeutic contexts.
Formula:C54H76N14O10
InChI:InChI=1/C54H76N14O10/c1-32(2)28-41(66-47(72)36(55)29-33-14-6-3-7-15-33)50(75)67-42(31-35-18-10-5-11-19-35)51(76)64-39(23-25-45(57)70)53(78)68-27-13-21-43(68)52(77)63-38(22-24-44(56)69)49(74)62-37(20-12-26-61-54(59)60)48(73)65-40(46(58)71)30-34-16-8-4-9-17-34/h3-11,14-19,32,36-43H,12-13,20-31,55H2,1-2H3,(H2,56,69)(H2,57,70)(H2,58,71)(H,62,74)(H,63,77)(H,64,76)(H,65,73)(H,66,72)(H,67,75)(H4,59,60,61)/t36-,37-,38-,39-,40-,41-,42-,43-/m0/s1
SMILES:CC(C)C[C@@H](C(=N[C@@H](Cc1ccccc1)C(=N[C@@H](CCC(=N)O)C(=O)N1CCC[C@H]1C(=N[C@@H](CCC(=N)O)C(=N[C@@H](CCCNC(=N)N)C(=N[C@@H](Cc1ccccc1)C(=N)O)O)O)O)O)O)N=C([C@H](Cc1ccccc1)N)O
Synonyms:- H-Phe-Leu-Phe-Gln-Pro-Gln-Arg-Phe-NH2
- Neuropeptide FF
- phenylalanyl-L-leucyl-L-phenylalanyl-L-glutaminyl-L-prolyl-L-glutaminyl-N~5~-(diaminomethylidene)-L-ornithylphenylalaninamide
- L-phenylalanyl-L-leucyl-L-phenylalanyl-L-glutaminyl-L-prolyl-L-glutaminyl-N~5~-(diaminomethylidene)-L-ornithyl-L-phenylalaninamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Neuropeptide FF
CAS:Neuropeptide FF (FLFQPQRF-amide) is an octapeptide implicated in a variety of physiological functions, including nociception, cardiovascular responses, and neuroendocrine regulation.Formula:C54H76N14O10Purity:98.4%Color and Shape:White LyophilisateMolecular weight:1081.29Neuropeptide FF H-Phe-Leu-Phe-Gln-Pro-Gln-Arg-Phe-NH2
CAS:Formula:C56H77F3N14O12Purity:98%Molecular weight:1195.2924Neuropeptide FF
CAS:<p>Endogenous antiopioid peptide and agonist at NPFF1 and NPFF2 receptors (Ki values are 2.82 and 0.21 nM respectively).</p>Formula:C54H76N14O10Purity:98%Color and Shape:SolidMolecular weight:1081.27Neuropeptide FF Morphine Modulating Neuropeptide F-8-F-NH2
CAS:<p>Catalogue peptide; min. 95% purity</p>Formula:C54H76N14O10Purity:Min. 95%Molecular weight:1,081.3 g/mol




