CAS 99584-33-5

1-Phenyl-1H-tetrazole-5-methanol

Description:

1-Phenyl-1H-tetrazole-5-methanol is an organic compound characterized by its tetrazole ring, which is a five-membered heterocyclic structure containing four nitrogen atoms and one carbon atom. This compound features a phenyl group attached to the tetrazole, contributing to its aromatic properties, and a hydroxymethyl group (-CH2OH) at the 5-position of the tetrazole ring, which enhances its solubility in polar solvents. The presence of the hydroxymethyl group also introduces potential for hydrogen bonding, influencing its reactivity and interactions with other molecules. 1-Phenyl-1H-tetrazole-5-methanol is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activities and applications in the synthesis of other chemical entities. Its stability, solubility, and reactivity can vary based on environmental conditions, such as pH and temperature. As with many tetrazole derivatives, it may exhibit interesting properties such as fluorescence or coordination capabilities with metal ions, making it a subject of research in coordination chemistry and drug development.

Formula: C₈H₈N₄O

InChI: InChI=1S/C8H8N4O/c13-6-8-9-10-11-12(8)7-4-2-1-3-5-7/h1-5,13H,6H2

InChI key: InChIKey=ACKJYBUCEWZWOG-UHFFFAOYSA-N

SMILES: C(O)C=1N(N=NN1)C2=CC=CC=C2

Synonyms:

• 1H-Tetrazole-5-methanol, 1-phenyl-
• 1-Phenyl-1H-tetrazole-5-methanol
• (1-Phenyl-1H-1,2,3,4-tetrazol-5-yl)methanol

(1-Phenyl-1H-1,2,3,4-tetrazol-5-yl)methanol

CAS: 99584-33-5

Versatile small molecule scaffold

Formula: C₈H₈N₄O

Purity: Min. 95%

Molecular weight: 176.18 g/mol

Ref: 3D-ZDA58433