CAS 99585-43-0

4-(3,4-dichlorophenoxy)-3-nitrobenzoic acid

Description:

4-(3,4-Dichlorophenoxy)-3-nitrobenzoic acid, with the CAS number 99585-43-0, is an organic compound characterized by its complex aromatic structure. It features a benzoic acid moiety substituted with a nitro group and a dichlorophenoxy group, which contributes to its chemical reactivity and potential applications. The presence of the nitro group typically enhances the compound's electrophilic properties, while the dichlorophenoxy group can influence its solubility and interaction with biological systems. This compound is often studied for its herbicidal properties, making it relevant in agricultural chemistry. Its molecular structure suggests it may exhibit specific interactions with enzymes or receptors in plants, leading to growth inhibition or other physiological effects. Additionally, the chlorine substituents can affect the compound's stability and environmental persistence. As with many organic compounds, safety and handling precautions are essential due to potential toxicity and environmental impact. Overall, 4-(3,4-dichlorophenoxy)-3-nitrobenzoic acid is a significant compound in the field of agrochemicals and organic synthesis.

Formula: C₁₃H₇Cl₂NO₅

InChI: InChI=1/C13H7Cl2NO5/c14-9-3-2-8(6-10(9)15)21-12-4-1-7(13(17)18)5-11(12)16(19)20/h1-6H,(H,17,18)