CAS 99585-91-8

2-Chloro-N-(3-chloro-5-methylphenyl)acetamide

Description:

2-Chloro-N-(3-chloro-5-methylphenyl)acetamide, with the CAS number 99585-91-8, is an organic compound characterized by its amide functional group. It features a chloro substituent on both the acetamide and the aromatic ring, which contributes to its chemical reactivity and potential biological activity. The presence of the methyl group on the phenyl ring influences its steric and electronic properties, potentially affecting its interactions in biological systems. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its structure suggests potential applications in pharmaceuticals or agrochemicals, where halogenated compounds often demonstrate enhanced activity or selectivity. Additionally, the presence of chlorine atoms can impart unique properties, such as increased lipophilicity or altered metabolic pathways. Safety and handling precautions are essential when working with this compound, as halogenated amides can pose health risks and environmental concerns.

Formula: C₉H₉Cl₂NO

InChI: InChI=1S/C9H9Cl2NO/c1-6-2-7(11)4-8(3-6)12-9(13)5-10/h2-4H,5H2,1H3,(H,12,13)

InChI key: InChIKey=ISCQVPGXEIJXON-UHFFFAOYSA-N

SMILES: N(C(CCl)=O)C1=CC(C)=CC(Cl)=C1

Synonyms:

• m-Acetotoluidide, 2,5′-dichloro-
• Acetamide, 2-chloro-N-(3-chloro-5-methylphenyl)-
• 2-Chloro-N-(3-chloro-5-methylphenyl)acetamide