CAS 99585-92-9

2-Chloro-N-(2-chloro-5-methylphenyl)acetamide

Description:

2-Chloro-N-(2-chloro-5-methylphenyl)acetamide is an organic compound characterized by its amide functional group, which is derived from acetic acid. The presence of two chlorine atoms and a methyl group on the aromatic ring contributes to its unique chemical properties. This compound typically appears as a solid at room temperature and is soluble in organic solvents, reflecting its hydrophobic characteristics. The chlorinated aromatic structure may impart biological activity, making it of interest in pharmaceutical and agrochemical research. Its molecular structure suggests potential reactivity in nucleophilic substitution reactions due to the presence of the acetamide moiety. Additionally, the compound may exhibit specific interactions with biological targets, which could be explored for therapeutic applications. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 2-Chloro-N-(2-chloro-5-methylphenyl)acetamide is a compound of interest in various chemical and biological contexts, warranting further investigation into its properties and applications.

Formula: C₉H₉Cl₂NO

InChI: InChI=1S/C9H9Cl2NO/c1-6-2-3-7(11)8(4-6)12-9(13)5-10/h2-4H,5H2,1H3,(H,12,13)

InChI key: InChIKey=TUIULJCXSZTGNE-UHFFFAOYSA-N

SMILES: N(C(CCl)=O)C1=C(Cl)C=CC(C)=C1

Synonyms:

• NSC 39582
• Acetamide, 2-chloro-N-(2-chloro-5-methylphenyl)-
• 2-Chloro-N-(2-chloro-5-methylphenyl)acetamide
• m-Acetotoluidide, 2,6′-dichloro-